C21H21NO5 — CID 23255422
(1R,3R,6S,7S,8S,10R)-4-benzyl-7-hydroxy-10-phenyl-2,9,11-trioxa-4-azatricyclo[6.4.0.03,6]dodecan-5-one (PubChem CID 23255422) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is (1R,3R,6S,7S,8S,10R)-4-benzyl-7-hydroxy-10-phenyl-2,9,11-trioxa-4-azatricyclo[6.4.0.03,6]dodecan-5-one.
| Compound Name | (1R,3R,6S,7S,8S,10R)-4-benzyl-7-hydroxy-10-phenyl-2,9,11-trioxa-4-azatricyclo[6.4.0.03,6]dodecan-5-one |
|---|---|
| PubChem CID | 23255422 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (1R,3R,6S,7S,8S,10R)-4-benzyl-7-hydroxy-10-phenyl-2,9,11-trioxa-4-azatricyclo[6.4.0.03,6]dodecan-5-one |
| SMILES | O=C1[C@H]2[C@H](O)[C@@H]3O[C@H](c4ccccc4)OC[C@H]3O[C@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C21H21NO5/c23-17-16-19(24)22(11-13-7-3-1-4-8-13)20(16)26-15-12-25-21(27-18(15)17)14-9-5-2-6-10-14/h1-10,15-18,20-21,23H,11-12H2/t15-,16-,17+,18-,20-,21-/m1/s1 |
| InChIKey | OZANENLRFQJBFC-WNWCJCMHSA-N |
| XLogP | 1.85 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |