C16H17NO3 — CID 124711383
(1R,2R,3R,6R,8S,9S,10R)-5-benzyl-9-hydroxy-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-4-one (PubChem CID 124711383) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is (1R,2R,3R,6R,8S,9S,10R)-5-benzyl-9-hydroxy-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-4-one.
| Compound Name | (1R,2R,3R,6R,8S,9S,10R)-5-benzyl-9-hydroxy-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-4-one |
|---|---|
| PubChem CID | 124711383 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (1R,2R,3R,6R,8S,9S,10R)-5-benzyl-9-hydroxy-7-oxa-5-azatetracyclo[6.3.0.02,6.03,10]undecan-4-one |
| SMILES | O=C1[C@@H]2[C@H]3C[C@H]4[C@H](O[C@H]([C@H]42)N1Cc1ccccc1)[C@H]3O |
| InChI | InChI=1S/C16H17NO3/c18-13-9-6-10-12-11(9)15(19)17(16(12)20-14(10)13)7-8-4-2-1-3-5-8/h1-5,9-14,16,18H,6-7H2/t9-,10-,11-,12-,13+,14+,16-/m1/s1 |
| InChIKey | JNIYESDZDSVWHU-SQDLRVPESA-N |
| XLogP | 1.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |