C17H24O8 — CID 57343453
(2R,4aR,6R,7R,8R,8aS)-6-[(2R)-2,3-dihydroxy-2-methylpropoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 57343453) has the molecular formula C17H24O8 and a molecular weight of 356.37 g/mol. Its IUPAC name is (2R,4aR,6R,7R,8R,8aS)-6-[(2R)-2,3-dihydroxy-2-methylpropoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (2R,4aR,6R,7R,8R,8aS)-6-[(2R)-2,3-dihydroxy-2-methylpropoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 57343453 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (2R,4aR,6R,7R,8R,8aS)-6-[(2R)-2,3-dihydroxy-2-methylpropoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | C[C@@](O)(CO)CO[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H24O8/c1-17(21,8-18)9-23-16-13(20)12(19)14-11(24-16)7-22-15(25-14)10-5-3-2-4-6-10/h2-6,11-16,18-21H,7-9H2,1H3/t11-,12-,13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | PDBHOIDRAJHOGU-OGDJNORSSA-N |
| XLogP | -0.69 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |