C18H28O6Si — CID 91030531
(4aR,7R,8R,8aR)-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 91030531) has the molecular formula C18H28O6Si and a molecular weight of 368.50 g/mol. Its IUPAC name is (4aR,7R,8R,8aR)-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,7R,8R,8aR)-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 91030531 |
| Molecular Formula | C18H28O6Si |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (4aR,7R,8R,8aR)-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | C[Si](C)(C)CCOC1O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H28O6Si/c1-25(2,3)10-9-21-18-15(20)14(19)16-13(23-18)11-22-17(24-16)12-7-5-4-6-8-12/h4-8,13-20H,9-11H2,1-3H3/t13-,14-,15-,16+,17?,18?/m1/s1 |
| InChIKey | VHVMJWGDZRGIAG-XKTBZMPXSA-N |
| XLogP | 1.90 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|