C26H36O7Si — CID 68732319
(4aR,6R,7R,8R,8aS)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 68732319) has the molecular formula C26H36O7Si and a molecular weight of 488.65 g/mol. Its IUPAC name is (4aR,6R,7R,8R,8aS)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (4aR,6R,7R,8R,8aS)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 68732319 |
| Molecular Formula | C26H36O7Si |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | (4aR,6R,7R,8R,8aS)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](O)[C@H](OCC[Si](C)(C)C)O[C@@H]3COC(c4ccccc4)O[C@H]23)cc1 |
| InChI | InChI=1S/C26H36O7Si/c1-28-20-12-10-18(11-13-20)16-30-24-22(27)26(29-14-15-34(2,3)4)32-21-17-31-25(33-23(21)24)19-8-6-5-7-9-19/h5-13,21-27H,14-17H2,1-4H3/t21-,22-,23+,24-,25?,26-/m1/s1 |
| InChIKey | YJCPXUWQUGMRTG-SKIKILBESA-N |
| XLogP | 4.14 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|