C23H28O8 — CID 10812626
(4aR,6S,7R,8S,8aS)-6-methoxy-2-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 10812626) has the molecular formula C23H28O8 and a molecular weight of 432.47 g/mol. Its IUPAC name is (4aR,6S,7R,8S,8aS)-6-methoxy-2-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (4aR,6S,7R,8S,8aS)-6-methoxy-2-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 10812626 |
| Molecular Formula | C23H28O8 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (4aR,6S,7R,8S,8aS)-6-methoxy-2-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | COc1ccc(CO[C@H]2[C@@H](OC)O[C@@H]3COC(c4ccc(OC)cc4)O[C@H]3[C@@H]2O)cc1 |
| InChI | InChI=1S/C23H28O8/c1-25-16-8-4-14(5-9-16)12-28-21-19(24)20-18(30-23(21)27-3)13-29-22(31-20)15-6-10-17(26-2)11-7-15/h4-11,18-24H,12-13H2,1-3H3/t18-,19+,20-,21-,22?,23+/m1/s1 |
| InChIKey | CAGYVTFYFPOVRP-VGPVBAISSA-N |
| XLogP | 2.44 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |