C17H22O7 — CID 102396251
(4aR,7R,8R,8aS)-2-(4-methoxyphenyl)-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 102396251) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is (4aR,7R,8R,8aS)-2-(4-methoxyphenyl)-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,7R,8R,8aS)-2-(4-methoxyphenyl)-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 102396251 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (4aR,7R,8R,8aS)-2-(4-methoxyphenyl)-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | C=CCOC1O[C@@H]2COC(c3ccc(OC)cc3)O[C@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H22O7/c1-3-8-21-17-14(19)13(18)15-12(23-17)9-22-16(24-15)10-4-6-11(20-2)7-5-10/h3-7,12-19H,1,8-9H2,2H3/t12-,13-,14-,15-,16?,17?/m1/s1 |
| InChIKey | NNGSKNYSTBWGNE-IIQOZLQZSA-N |
| XLogP | 0.76 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|