C16H21NO8 — CID 118005593
2-[[(4aR,6R,7R,8R,8aS)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethylcarbamic acid (PubChem CID 118005593) has the molecular formula C16H21NO8 and a molecular weight of 355.34 g/mol. Its IUPAC name is 2-[[(4aR,6R,7R,8R,8aS)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethylcarbamic acid.
| Compound Name | 2-[[(4aR,6R,7R,8R,8aS)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 118005593 |
| Molecular Formula | C16H21NO8 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-[[(4aR,6R,7R,8R,8aS)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H21NO8/c18-11-12(19)15(22-7-6-17-16(20)21)24-10-8-23-14(25-13(10)11)9-4-2-1-3-5-9/h1-5,10-15,17-19H,6-8H2,(H,20,21)/t10-,11-,12-,13-,14?,15-/m1/s1 |
| InChIKey | BJMXVVIDBWXVCC-CVRPCMMBSA-N |
| XLogP | -0.17 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|