C16H22O8 — CID 57343452
(2R,4aR,6R,7R,8R,8aS)-6-[(2R)-2,3-dihydroxypropoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 57343452) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is (2R,4aR,6R,7R,8R,8aS)-6-[(2R)-2,3-dihydroxypropoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (2R,4aR,6R,7R,8R,8aS)-6-[(2R)-2,3-dihydroxypropoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 57343452 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (2R,4aR,6R,7R,8R,8aS)-6-[(2R)-2,3-dihydroxypropoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | OC[C@@H](O)CO[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H22O8/c17-6-10(18)7-21-16-13(20)12(19)14-11(23-16)8-22-15(24-14)9-4-2-1-3-5-9/h1-5,10-20H,6-8H2/t10-,11-,12-,13-,14-,15-,16-/m1/s1 |
| InChIKey | QAUSSXOUGAXKNN-HEDAIKSVSA-N |
| XLogP | -1.08 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |