C26H31NO7Si — CID 14215400
2-[(4aR,6R,7R,8R,8aS)-8-hydroxy-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]isoindole-1,3-dione (PubChem CID 14215400) has the molecular formula C26H31NO7Si and a molecular weight of 497.62 g/mol. Its IUPAC name is 2-[(4aR,6R,7R,8R,8aS)-8-hydroxy-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]isoindole-1,3-dione.
| Compound Name | 2-[(4aR,6R,7R,8R,8aS)-8-hydroxy-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 14215400 |
| Molecular Formula | C26H31NO7Si |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 2-[(4aR,6R,7R,8R,8aS)-8-hydroxy-2-phenyl-6-(2-trimethylsilylethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]isoindole-1,3-dione |
| SMILES | C[Si](C)(C)CCO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](O)[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H31NO7Si/c1-35(2,3)14-13-31-26-20(27-23(29)17-11-7-8-12-18(17)24(27)30)21(28)22-19(33-26)15-32-25(34-22)16-9-5-4-6-10-16/h4-12,19-22,25-26,28H,13-15H2,1-3H3/t19-,20-,21-,22-,25?,26-/m1/s1 |
| InChIKey | IPLULCJJVAYTLQ-OZEUICFISA-N |
| XLogP | 3.21 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|