C19H18Cl6FNO8 — CID 102508322
[(4aR,6S,7R,8R,8aR)-6-fluoro-2-phenyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl carbonate (PubChem CID 102508322) has the molecular formula C19H18Cl6FNO8 and a molecular weight of 620.07 g/mol. Its IUPAC name is [(4aR,6S,7R,8R,8aR)-6-fluoro-2-phenyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl carbonate.
| Compound Name | [(4aR,6S,7R,8R,8aR)-6-fluoro-2-phenyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 102508322 |
| Molecular Formula | C19H18Cl6FNO8 |
| Molecular Weight | 620.07 g/mol |
| Exact Mass | 616.91 |
| IUPAC Name | [(4aR,6S,7R,8R,8aR)-6-fluoro-2-phenyl-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2,2-trichloroethyl carbonate |
| SMILES | O=C(N[C@@H]1[C@@H](OC(=O)OCC(Cl)(Cl)Cl)[C@H]2OC(c3ccccc3)OC[C@H]2O[C@H]1F)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H18Cl6FNO8/c20-18(21,22)7-31-16(28)27-11-13(35-17(29)32-8-19(23,24)25)12-10(33-14(11)26)6-30-15(34-12)9-4-2-1-3-5-9/h1-5,10-15H,6-8H2,(H,27,28)/t10-,11-,12+,13-,14-,15?/m1/s1 |
| InChIKey | VZAZEMPNCAFXLS-SPETUVNMSA-N |
| XLogP | 5.15 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.07 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|