C25H24Cl6N2O7 — CID 91261038
[(6S,7R,8aS)-2-phenyl-8-phenylmethoxy-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2,2-trichloroethanimidate (PubChem CID 91261038) has the molecular formula C25H24Cl6N2O7 and a molecular weight of 677.19 g/mol. Its IUPAC name is [(6S,7R,8aS)-2-phenyl-8-phenylmethoxy-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(6S,7R,8aS)-2-phenyl-8-phenylmethoxy-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 91261038 |
| Molecular Formula | C25H24Cl6N2O7 |
| Molecular Weight | 677.19 g/mol |
| Exact Mass | 673.97 |
| IUPAC Name | [(6S,7R,8aS)-2-phenyl-8-phenylmethoxy-7-(2,2,2-trichloroethoxycarbonylamino)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H]1OC2COC(c3ccccc3)O[C@H]2C(OCc2ccccc2)[C@H]1NC(=O)OCC(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C25H24Cl6N2O7/c26-24(27,28)13-37-23(34)33-17-19(35-11-14-7-3-1-4-8-14)18-16(38-21(17)40-22(32)25(29,30)31)12-36-20(39-18)15-9-5-2-6-10-15/h1-10,16-21,32H,11-13H2,(H,33,34)/b32-22+/t16?,17-,18-,19?,20?,21+/m1/s1 |
| InChIKey | HZOLTXBVAIHCFZ-ZTALWJHUSA-N |
| XLogP | 6.24 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.19 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|