C27H25NO6 — CID 85342909
4-[5-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methyl-1,3-dioxan-2-yl]benzoic acid (PubChem CID 85342909) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is 4-[5-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methyl-1,3-dioxan-2-yl]benzoic acid.
| Compound Name | 4-[5-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methyl-1,3-dioxan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 85342909 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 4-[5-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methyl-1,3-dioxan-2-yl]benzoic acid |
| SMILES | CC1OC(c2ccc(C(=O)O)cc2)OCC1NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H25NO6/c1-16-24(15-32-26(34-16)18-12-10-17(11-13-18)25(29)30)28-27(31)33-14-23-21-8-4-2-6-19(21)20-7-3-5-9-22(20)23/h2-13,16,23-24,26H,14-15H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | WLFXKBDLHCXMDM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |