C19H19NO4 — CID 130689635
9H-fluoren-9-ylmethyl N-[(3R,4S)-4-hydroxyoxolan-3-yl]carbamate (PubChem CID 130689635) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(3R,4S)-4-hydroxyoxolan-3-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(3R,4S)-4-hydroxyoxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 130689635 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(3R,4S)-4-hydroxyoxolan-3-yl]carbamate |
| SMILES | O=C(N[C@@H]1COC[C@H]1O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H19NO4/c21-18-11-23-10-17(18)20-19(22)24-9-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-18,21H,9-11H2,(H,20,22)/t17-,18-/m1/s1 |
| InChIKey | SAQSZNBNWRHPDN-QZTJIDSGSA-N |
| XLogP | 2.28 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |