C28H22N2O7 — CID 178193977
(1,3-dioxoisoindol-2-yl) (3S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)oxolane-3-carboxylate (PubChem CID 178193977) has the molecular formula C28H22N2O7 and a molecular weight of 498.49 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) (3S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)oxolane-3-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl) (3S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 178193977 |
| Molecular Formula | C28H22N2O7 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) (3S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)oxolane-3-carboxylate |
| SMILES | O=C(N[C@H]1COC[C@H]1C(=O)ON1C(=O)c2ccccc2C1=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H22N2O7/c31-25-20-11-5-6-12-21(20)26(32)30(25)37-27(33)23-13-35-15-24(23)29-28(34)36-14-22-18-9-3-1-7-16(18)17-8-2-4-10-19(17)22/h1-12,22-24H,13-15H2,(H,29,34)/t23-,24+/m1/s1 |
| InChIKey | WOZHTLMOZVAOOZ-RPWUZVMVSA-N |
| XLogP | 3.29 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|