C22H28N2O6 — CID 178195175
cis-(1,3-dioxoisoindol-2-yl) (1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclooctane-1-carboxylate (PubChem CID 178195175) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is cis-(1,3-dioxoisoindol-2-yl) (1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclooctane-1-carboxylate.
| Compound Name | cis-(1,3-dioxoisoindol-2-yl) (1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclooctane-1-carboxylate |
|---|---|
| PubChem CID | 178195175 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | cis-(1,3-dioxoisoindol-2-yl) (1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclooctane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCCC[C@H]1C(=O)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H28N2O6/c1-22(2,3)29-21(28)23-17-13-7-5-4-6-12-16(17)20(27)30-24-18(25)14-10-8-9-11-15(14)19(24)26/h8-11,16-17H,4-7,12-13H2,1-3H3,(H,23,28)/t16-,17+/m1/s1 |
| InChIKey | DNKPAVDZHZVKAU-SJORKVTESA-N |
| XLogP | 3.60 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|