C19H24N2O4 — CID 163830103
tert-butyl N-[(2R)-2-(1,3-dioxoisoindol-2-yl)cyclohexyl]carbamate (PubChem CID 163830103) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-(1,3-dioxoisoindol-2-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-(1,3-dioxoisoindol-2-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 163830103 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | tert-butyl N-[(2R)-2-(1,3-dioxoisoindol-2-yl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCC[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H24N2O4/c1-19(2,3)25-18(24)20-14-10-6-7-11-15(14)21-16(22)12-8-4-5-9-13(12)17(21)23/h4-5,8-9,14-15H,6-7,10-11H2,1-3H3,(H,20,24)/t14?,15-/m1/s1 |
| InChIKey | OCYHKWRRLRHYDF-YSSOQSIOSA-N |
| XLogP | 3.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|