C18H23N3O4 — CID 131732939
tert-butyl N-[4-(1,3-dioxoisoindol-2-yl)piperidin-3-yl]carbamate (PubChem CID 131732939) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is tert-butyl N-[4-(1,3-dioxoisoindol-2-yl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[4-(1,3-dioxoisoindol-2-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 131732939 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | tert-butyl N-[4-(1,3-dioxoisoindol-2-yl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CNCCC1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H23N3O4/c1-18(2,3)25-17(24)20-13-10-19-9-8-14(13)21-15(22)11-6-4-5-7-12(11)16(21)23/h4-7,13-14,19H,8-10H2,1-3H3,(H,20,24) |
| InChIKey | QULUITMQXJRHBH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|