C19H20F2N2O6 — CID 170335608
(1,3-dioxoisoindol-2-yl) 4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate (PubChem CID 170335608) has the molecular formula C19H20F2N2O6 and a molecular weight of 410.37 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 170335608 |
| Molecular Formula | C19H20F2N2O6 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NC1CC(F)(F)CC1C(=O)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H20F2N2O6/c1-18(2,3)28-17(27)22-13-9-19(20,21)8-12(13)16(26)29-23-14(24)10-6-4-5-7-11(10)15(23)25/h4-7,12-13H,8-9H2,1-3H3,(H,22,27) |
| InChIKey | WUFRGFYILAUNHM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|