C22H28N2O6 — CID 142436754
(1,3-dioxoisoindol-2-yl) 2-[1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]acetate (PubChem CID 142436754) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 2-[1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]acetate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 2-[1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 142436754 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 2-[1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]acetate |
| SMILES | CC(C)(C)OC(=O)NCC1(CC(=O)ON2C(=O)c3ccccc3C2=O)CCCCC1 |
| InChI | InChI=1S/C22H28N2O6/c1-21(2,3)29-20(28)23-14-22(11-7-4-8-12-22)13-17(25)30-24-18(26)15-9-5-6-10-16(15)19(24)27/h5-6,9-10H,4,7-8,11-14H2,1-3H3,(H,23,28) |
| InChIKey | JXEMTZUTOWRDSA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|