C15H18N2O4S — CID 91757236
tert-butyl N-[2-(1,3-dioxoisoindol-2-yl)sulfanylethyl]carbamate (PubChem CID 91757236) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is tert-butyl N-[2-(1,3-dioxoisoindol-2-yl)sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-(1,3-dioxoisoindol-2-yl)sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 91757236 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | tert-butyl N-[2-(1,3-dioxoisoindol-2-yl)sulfanylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H18N2O4S/c1-15(2,3)21-14(20)16-8-9-22-17-12(18)10-6-4-5-7-11(10)13(17)19/h4-7H,8-9H2,1-3H3,(H,16,20) |
| InChIKey | UMAYDYJWQGNYHW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|