C26H30N2O6 — CID 130422004
ethyl 2-[4-[1-(1,3-dioxoisoindol-2-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]acetate (PubChem CID 130422004) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is ethyl 2-[4-[1-(1,3-dioxoisoindol-2-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[1-(1,3-dioxoisoindol-2-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]acetate |
|---|---|
| PubChem CID | 130422004 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | ethyl 2-[4-[1-(1,3-dioxoisoindol-2-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C(CCNC(=O)OC(C)(C)C)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H30N2O6/c1-5-33-22(29)16-17-10-12-18(13-11-17)21(14-15-27-25(32)34-26(2,3)4)28-23(30)19-8-6-7-9-20(19)24(28)31/h6-13,21H,5,14-16H2,1-4H3,(H,27,32) |
| InChIKey | XISUDCGIDHPNGR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|