C25H33NO4 — CID 91309476
ethyl (4S)-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5-(4-phenylphenyl)pentanoate (PubChem CID 91309476) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is ethyl (4S)-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5-(4-phenylphenyl)pentanoate.
| Compound Name | ethyl (4S)-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5-(4-phenylphenyl)pentanoate |
|---|---|
| PubChem CID | 91309476 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | ethyl (4S)-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5-(4-phenylphenyl)pentanoate |
| SMILES | CCOC(=O)CC[C@H](CNC(=O)OC(C)(C)C)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H33NO4/c1-5-29-23(27)16-13-20(18-26-24(28)30-25(2,3)4)17-19-11-14-22(15-12-19)21-9-7-6-8-10-21/h6-12,14-15,20H,5,13,16-18H2,1-4H3,(H,26,28)/t20-/m0/s1 |
| InChIKey | HDPJKJRKLPYKFY-FQEVSTJZSA-N |
| XLogP | 5.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |