C20H21NO4S — CID 149348280
tert-butyl 4-(1,3-dioxoisoindol-2-yl)-4-thiophen-3-ylbutanoate (PubChem CID 149348280) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is tert-butyl 4-(1,3-dioxoisoindol-2-yl)-4-thiophen-3-ylbutanoate.
| Compound Name | tert-butyl 4-(1,3-dioxoisoindol-2-yl)-4-thiophen-3-ylbutanoate |
|---|---|
| PubChem CID | 149348280 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | tert-butyl 4-(1,3-dioxoisoindol-2-yl)-4-thiophen-3-ylbutanoate |
| SMILES | CC(C)(C)OC(=O)CCC(c1ccsc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H21NO4S/c1-20(2,3)25-17(22)9-8-16(13-10-11-26-12-13)21-18(23)14-6-4-5-7-15(14)19(21)24/h4-7,10-12,16H,8-9H2,1-3H3 |
| InChIKey | YFMRZOIXYVMKGP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|