C26H38N4O7 — CID 71275598
ditert-butyl (2S)-2-[[4-(1,3-dioxoisoindol-2-yl)butylamino]carbamoylamino]pentanedioate (PubChem CID 71275598) has the molecular formula C26H38N4O7 and a molecular weight of 518.61 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[4-(1,3-dioxoisoindol-2-yl)butylamino]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[4-(1,3-dioxoisoindol-2-yl)butylamino]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 71275598 |
| Molecular Formula | C26H38N4O7 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | ditert-butyl (2S)-2-[[4-(1,3-dioxoisoindol-2-yl)butylamino]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)NNCCCCN1C(=O)c2ccccc2C1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H38N4O7/c1-25(2,3)36-20(31)14-13-19(23(34)37-26(4,5)6)28-24(35)29-27-15-9-10-16-30-21(32)17-11-7-8-12-18(17)22(30)33/h7-8,11-12,19,27H,9-10,13-16H2,1-6H3,(H2,28,29,35)/t19-/m0/s1 |
| InChIKey | GRYSHZDGYMYLHV-IBGZPJMESA-N |
| XLogP | 2.70 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|