C37H56N4O8 — CID 155588243
ditert-butyl (2S)-2-[[(2S)-6-[[(2S)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate (PubChem CID 155588243) has the molecular formula C37H56N4O8 and a molecular weight of 684.88 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(2S)-6-[[(2S)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(2S)-6-[[(2S)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 155588243 |
| Molecular Formula | C37H56N4O8 |
| Molecular Weight | 684.88 g/mol |
| Exact Mass | 684.41 |
| IUPAC Name | ditert-butyl (2S)-2-[[(2S)-6-[[(2S)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)[C@@H](N)Cc1ccc2ccccc2c1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H56N4O8/c1-35(2,3)47-30(42)20-19-29(33(45)49-37(7,8)9)41-34(46)40-28(32(44)48-36(4,5)6)16-12-13-21-39-31(43)27(38)23-24-17-18-25-14-10-11-15-26(25)22-24/h10-11,14-15,17-18,22,27-29H,12-13,16,19-21,23,38H2,1-9H3,(H,39,43)(H2,40,41,46)/t27-,28-,29-/m0/s1 |
| InChIKey | KWNNWBNRQAIFER-AWCRTANDSA-N |
| XLogP | 4.84 |
| TPSA | 175.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.88 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|