C28H44N4O7 — CID 58099945
tert-butyl 4-[[1-[(2-methylpropan-2-yl)oxy]-1-oxo-6-(phenylcarbamoylamino)hexan-2-yl]carbamoylamino]-5-oxohexanoate (PubChem CID 58099945) has the molecular formula C28H44N4O7 and a molecular weight of 548.68 g/mol. Its IUPAC name is tert-butyl 4-[[1-[(2-methylpropan-2-yl)oxy]-1-oxo-6-(phenylcarbamoylamino)hexan-2-yl]carbamoylamino]-5-oxohexanoate.
| Compound Name | tert-butyl 4-[[1-[(2-methylpropan-2-yl)oxy]-1-oxo-6-(phenylcarbamoylamino)hexan-2-yl]carbamoylamino]-5-oxohexanoate |
|---|---|
| PubChem CID | 58099945 |
| Molecular Formula | C28H44N4O7 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | tert-butyl 4-[[1-[(2-methylpropan-2-yl)oxy]-1-oxo-6-(phenylcarbamoylamino)hexan-2-yl]carbamoylamino]-5-oxohexanoate |
| SMILES | CC(=O)C(CCC(=O)OC(C)(C)C)NC(=O)NC(CCCCNC(=O)Nc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H44N4O7/c1-19(33)21(16-17-23(34)38-27(2,3)4)31-26(37)32-22(24(35)39-28(5,6)7)15-11-12-18-29-25(36)30-20-13-9-8-10-14-20/h8-10,13-14,21-22H,11-12,15-18H2,1-7H3,(H2,29,30,36)(H2,31,32,37) |
| InChIKey | ZJXUEJQRHPEFPI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|