C31H49IN4O8 — CID 44520089
ditert-butyl (2S)-2-[[6-[(3-iodophenyl)carbamoylamino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate (PubChem CID 44520089) has the molecular formula C31H49IN4O8 and a molecular weight of 732.66 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[6-[(3-iodophenyl)carbamoylamino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[6-[(3-iodophenyl)carbamoylamino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 44520089 |
| Molecular Formula | C31H49IN4O8 |
| Molecular Weight | 732.66 g/mol |
| Exact Mass | 732.26 |
| IUPAC Name | ditert-butyl (2S)-2-[[6-[(3-iodophenyl)carbamoylamino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)NC(CCCCNC(=O)Nc1cccc(I)c1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H49IN4O8/c1-29(2,3)42-24(37)17-16-23(26(39)44-31(7,8)9)36-28(41)35-22(25(38)43-30(4,5)6)15-10-11-18-33-27(40)34-21-14-12-13-20(32)19-21/h12-14,19,22-23H,10-11,15-18H2,1-9H3,(H2,33,34,40)(H2,35,36,41)/t22?,23-/m0/s1 |
| InChIKey | LULSBLPITLPFDQ-WCSIJFPASA-N |
| XLogP | 5.42 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.66 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|