C30H47FN4O8 — CID 71270611
ditert-butyl (2S)-2-[[(2S)-6-[(2-fluoropyridine-4-carbonyl)amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate (PubChem CID 71270611) has the molecular formula C30H47FN4O8 and a molecular weight of 610.72 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(2S)-6-[(2-fluoropyridine-4-carbonyl)amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(2S)-6-[(2-fluoropyridine-4-carbonyl)amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 71270611 |
| Molecular Formula | C30H47FN4O8 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | ditert-butyl (2S)-2-[[(2S)-6-[(2-fluoropyridine-4-carbonyl)amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)c1ccnc(F)c1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H47FN4O8/c1-28(2,3)41-23(36)14-13-21(26(39)43-30(7,8)9)35-27(40)34-20(25(38)42-29(4,5)6)12-10-11-16-33-24(37)19-15-17-32-22(31)18-19/h15,17-18,20-21H,10-14,16H2,1-9H3,(H,33,37)(H2,34,35,40)/t20-,21-/m0/s1 |
| InChIKey | ROZWELDTAGNVEI-SFTDATJTSA-N |
| XLogP | 3.96 |
| TPSA | 162.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|