C36H55N5O8 — CID 155588033
ditert-butyl (2S)-2-[[(2S)-6-[[(2R)-2-amino-3-isoquinolin-6-ylpropanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate (PubChem CID 155588033) has the molecular formula C36H55N5O8 and a molecular weight of 685.86 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(2S)-6-[[(2R)-2-amino-3-isoquinolin-6-ylpropanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(2S)-6-[[(2R)-2-amino-3-isoquinolin-6-ylpropanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 155588033 |
| Molecular Formula | C36H55N5O8 |
| Molecular Weight | 685.86 g/mol |
| Exact Mass | 685.41 |
| IUPAC Name | ditert-butyl (2S)-2-[[(2S)-6-[[(2R)-2-amino-3-isoquinolin-6-ylpropanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)[C@H](N)Cc1ccc2cnccc2c1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H55N5O8/c1-34(2,3)47-29(42)16-15-28(32(45)49-36(7,8)9)41-33(46)40-27(31(44)48-35(4,5)6)12-10-11-18-39-30(43)26(37)21-23-13-14-25-22-38-19-17-24(25)20-23/h13-14,17,19-20,22,26-28H,10-12,15-16,18,21,37H2,1-9H3,(H,39,43)(H2,40,41,46)/t26-,27+,28+/m1/s1 |
| InChIKey | MNSIHMXFGFGZJS-PKTNWEFCSA-N |
| XLogP | 4.23 |
| TPSA | 188.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.86 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|