C38H58N4O9 — CID 155588226
ditert-butyl (2S)-2-[[(2S)-6-[[(2R)-2-amino-3-(4-methoxynaphthalen-2-yl)propanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate (PubChem CID 155588226) has the molecular formula C38H58N4O9 and a molecular weight of 714.90 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(2S)-6-[[(2R)-2-amino-3-(4-methoxynaphthalen-2-yl)propanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(2S)-6-[[(2R)-2-amino-3-(4-methoxynaphthalen-2-yl)propanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 155588226 |
| Molecular Formula | C38H58N4O9 |
| Molecular Weight | 714.90 g/mol |
| Exact Mass | 714.42 |
| IUPAC Name | ditert-butyl (2S)-2-[[(2S)-6-[[(2R)-2-amino-3-(4-methoxynaphthalen-2-yl)propanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
| SMILES | COc1cc(C[C@@H](N)C(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc2ccccc12 |
| InChI | InChI=1S/C38H58N4O9/c1-36(2,3)49-31(43)19-18-29(34(46)51-38(7,8)9)42-35(47)41-28(33(45)50-37(4,5)6)17-13-14-20-40-32(44)27(39)22-24-21-25-15-11-12-16-26(25)30(23-24)48-10/h11-12,15-16,21,23,27-29H,13-14,17-20,22,39H2,1-10H3,(H,40,44)(H2,41,42,47)/t27-,28+,29+/m1/s1 |
| InChIKey | PXFHJAWMHVPHEL-ULNSLHSMSA-N |
| XLogP | 4.85 |
| TPSA | 184.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.90 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|