C35H54N4O8S — CID 155588282
ditert-butyl (2S)-2-[[(2S)-6-[[(2S)-2-amino-3-(1-benzothiophen-3-yl)propanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate (PubChem CID 155588282) has the molecular formula C35H54N4O8S and a molecular weight of 690.90 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(2S)-6-[[(2S)-2-amino-3-(1-benzothiophen-3-yl)propanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(2S)-6-[[(2S)-2-amino-3-(1-benzothiophen-3-yl)propanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 155588282 |
| Molecular Formula | C35H54N4O8S |
| Molecular Weight | 690.90 g/mol |
| Exact Mass | 690.37 |
| IUPAC Name | ditert-butyl (2S)-2-[[(2S)-6-[[(2S)-2-amino-3-(1-benzothiophen-3-yl)propanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)[C@@H](N)Cc1csc2ccccc12)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H54N4O8S/c1-33(2,3)45-28(40)18-17-26(31(43)47-35(7,8)9)39-32(44)38-25(30(42)46-34(4,5)6)15-12-13-19-37-29(41)24(36)20-22-21-48-27-16-11-10-14-23(22)27/h10-11,14,16,21,24-26H,12-13,15,17-20,36H2,1-9H3,(H,37,41)(H2,38,39,44)/t24-,25-,26-/m0/s1 |
| InChIKey | KQDHQARPFRAMEX-GSDHBNRESA-N |
| XLogP | 4.90 |
| TPSA | 175.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.90 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|