C30H47IN4O7 — CID 170086551
ditert-butyl (2S)-2-[[(3S)-7-[[(2S)-2-amino-3-(2-iodophenyl)propanoyl]amino]-2-oxoheptan-3-yl]carbamoylamino]pentanedioate (PubChem CID 170086551) has the molecular formula C30H47IN4O7 and a molecular weight of 702.63 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(3S)-7-[[(2S)-2-amino-3-(2-iodophenyl)propanoyl]amino]-2-oxoheptan-3-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(3S)-7-[[(2S)-2-amino-3-(2-iodophenyl)propanoyl]amino]-2-oxoheptan-3-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 170086551 |
| Molecular Formula | C30H47IN4O7 |
| Molecular Weight | 702.63 g/mol |
| Exact Mass | 702.25 |
| IUPAC Name | ditert-butyl (2S)-2-[[(3S)-7-[[(2S)-2-amino-3-(2-iodophenyl)propanoyl]amino]-2-oxoheptan-3-yl]carbamoylamino]pentanedioate |
| SMILES | CC(=O)[C@H](CCCCNC(=O)[C@@H](N)Cc1ccccc1I)NC(=O)N[C@@H](CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H47IN4O7/c1-19(36)23(14-10-11-17-33-26(38)22(32)18-20-12-8-9-13-21(20)31)34-28(40)35-24(27(39)42-30(5,6)7)15-16-25(37)41-29(2,3)4/h8-9,12-13,22-24H,10-11,14-18,32H2,1-7H3,(H,33,38)(H2,34,35,40)/t22-,23-,24-/m0/s1 |
| InChIKey | GABHLERBZMXLKC-HJOGWXRNSA-N |
| XLogP | 3.54 |
| TPSA | 165.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|