C33H46IN5O9S — CID 67428891
tert-butyl 6-[(3-iodobenzoyl)amino]-2-[[1-[(2-methylpropan-2-yl)oxy]-1,5-dioxo-5-(4-sulfamoylanilino)pentan-2-yl]carbamoylamino]hexanoate (PubChem CID 67428891) has the molecular formula C33H46IN5O9S and a molecular weight of 815.73 g/mol. Its IUPAC name is tert-butyl 6-[(3-iodobenzoyl)amino]-2-[[1-[(2-methylpropan-2-yl)oxy]-1,5-dioxo-5-(4-sulfamoylanilino)pentan-2-yl]carbamoylamino]hexanoate.
| Compound Name | tert-butyl 6-[(3-iodobenzoyl)amino]-2-[[1-[(2-methylpropan-2-yl)oxy]-1,5-dioxo-5-(4-sulfamoylanilino)pentan-2-yl]carbamoylamino]hexanoate |
|---|---|
| PubChem CID | 67428891 |
| Molecular Formula | C33H46IN5O9S |
| Molecular Weight | 815.73 g/mol |
| Exact Mass | 815.21 |
| IUPAC Name | tert-butyl 6-[(3-iodobenzoyl)amino]-2-[[1-[(2-methylpropan-2-yl)oxy]-1,5-dioxo-5-(4-sulfamoylanilino)pentan-2-yl]carbamoylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)C(CCCCNC(=O)c1cccc(I)c1)NC(=O)NC(CCC(=O)Nc1ccc(S(N)(=O)=O)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H46IN5O9S/c1-32(2,3)47-29(42)25(12-7-8-19-36-28(41)21-10-9-11-22(34)20-21)38-31(44)39-26(30(43)48-33(4,5)6)17-18-27(40)37-23-13-15-24(16-14-23)49(35,45)46/h9-11,13-16,20,25-26H,7-8,12,17-19H2,1-6H3,(H,36,41)(H,37,40)(H2,35,45,46)(H2,38,39,44) |
| InChIKey | HSQCTDRKCUCHHH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 212.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.73 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|