C22H30N4O6S — CID 122420497
tert-butyl N-[4-[4-[(4-sulfamoylphenyl)carbamoylamino]phenoxy]butyl]carbamate (PubChem CID 122420497) has the molecular formula C22H30N4O6S and a molecular weight of 478.57 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[(4-sulfamoylphenyl)carbamoylamino]phenoxy]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[(4-sulfamoylphenyl)carbamoylamino]phenoxy]butyl]carbamate |
|---|---|
| PubChem CID | 122420497 |
| Molecular Formula | C22H30N4O6S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | tert-butyl N-[4-[4-[(4-sulfamoylphenyl)carbamoylamino]phenoxy]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCOc1ccc(NC(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H30N4O6S/c1-22(2,3)32-21(28)24-14-4-5-15-31-18-10-6-16(7-11-18)25-20(27)26-17-8-12-19(13-9-17)33(23,29)30/h6-13H,4-5,14-15H2,1-3H3,(H,24,28)(H2,23,29,30)(H2,25,26,27) |
| InChIKey | RYRXOSVXFKONBZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|