C19H30N2O5 — CID 15850730
methyl (2S)-2-amino-3-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]phenyl]propanoate (PubChem CID 15850730) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-amino-3-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 15850730 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | methyl (2S)-2-amino-3-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(OCCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H30N2O5/c1-19(2,3)26-18(23)21-11-5-6-12-25-15-9-7-14(8-10-15)13-16(20)17(22)24-4/h7-10,16H,5-6,11-13,20H2,1-4H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | KFDSCUVTSULZPM-INIZCTEOSA-N |
| XLogP | 2.41 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|