C24H31NO6S — CID 18626019
methyl 3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-2-(4-methylsulfanylphenoxy)propanoate (PubChem CID 18626019) has the molecular formula C24H31NO6S and a molecular weight of 461.58 g/mol. Its IUPAC name is methyl 3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-2-(4-methylsulfanylphenoxy)propanoate.
| Compound Name | methyl 3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-2-(4-methylsulfanylphenoxy)propanoate |
|---|---|
| PubChem CID | 18626019 |
| Molecular Formula | C24H31NO6S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | methyl 3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-2-(4-methylsulfanylphenoxy)propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCNC(=O)OC(C)(C)C)cc1)Oc1ccc(SC)cc1 |
| InChI | InChI=1S/C24H31NO6S/c1-24(2,3)31-23(27)25-14-15-29-18-8-6-17(7-9-18)16-21(22(26)28-4)30-19-10-12-20(32-5)13-11-19/h6-13,21H,14-16H2,1-5H3,(H,25,27) |
| InChIKey | WNMBMCSTBRDTLO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|