C20H28N2O7 — CID 171776922
(2S)-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-2-(prop-2-enoxycarbonylamino)propanoic acid (PubChem CID 171776922) has the molecular formula C20H28N2O7 and a molecular weight of 408.45 g/mol. Its IUPAC name is (2S)-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-2-(prop-2-enoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-2-(prop-2-enoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 171776922 |
| Molecular Formula | C20H28N2O7 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | (2S)-3-[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]phenyl]-2-(prop-2-enoxycarbonylamino)propanoic acid |
| SMILES | C=CCOC(=O)N[C@@H](Cc1ccc(OCCNC(=O)OC(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C20H28N2O7/c1-5-11-28-19(26)22-16(17(23)24)13-14-6-8-15(9-7-14)27-12-10-21-18(25)29-20(2,3)4/h5-9,16H,1,10-13H2,2-4H3,(H,21,25)(H,22,26)(H,23,24)/t16-/m0/s1 |
| InChIKey | KAEOIWMSALQJJP-INIZCTEOSA-N |
| XLogP | 2.50 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|