C24H35N3O7 — CID 77431672
6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[3-phenyl-2-(prop-2-enoxycarbonylamino)propanoyl]amino]hexanoic acid (PubChem CID 77431672) has the molecular formula C24H35N3O7 and a molecular weight of 477.56 g/mol. Its IUPAC name is 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[3-phenyl-2-(prop-2-enoxycarbonylamino)propanoyl]amino]hexanoic acid.
| Compound Name | 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[3-phenyl-2-(prop-2-enoxycarbonylamino)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 77431672 |
| Molecular Formula | C24H35N3O7 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[3-phenyl-2-(prop-2-enoxycarbonylamino)propanoyl]amino]hexanoic acid |
| SMILES | C=CCOC(=O)NC(Cc1ccccc1)C(=O)NC(CCCCNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C24H35N3O7/c1-5-15-33-23(32)27-19(16-17-11-7-6-8-12-17)20(28)26-18(21(29)30)13-9-10-14-25-22(31)34-24(2,3)4/h5-8,11-12,18-19H,1,9-10,13-16H2,2-4H3,(H,25,31)(H,26,28)(H,27,32)(H,29,30) |
| InChIKey | QBUFZPRTXUOOTA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|