C29H43N3O9 — CID 145450687
(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-phenylpropanoyl]amino]-5-(prop-2-enoxycarbonylamino)pentanoic acid (PubChem CID 145450687) has the molecular formula C29H43N3O9 and a molecular weight of 577.68 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-phenylpropanoyl]amino]-5-(prop-2-enoxycarbonylamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-phenylpropanoyl]amino]-5-(prop-2-enoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 145450687 |
| Molecular Formula | C29H43N3O9 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-phenylpropanoyl]amino]-5-(prop-2-enoxycarbonylamino)pentanoic acid |
| SMILES | C=CCOC(=O)NCCC[C@H](NC(=O)[C@H](Cc1ccccc1)N(CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C29H43N3O9/c1-8-17-39-26(37)30-16-12-15-21(25(35)36)31-24(34)22(18-20-13-10-9-11-14-20)32(27(38)41-29(5,6)7)19-23(33)40-28(2,3)4/h8-11,13-14,21-22H,1,12,15-19H2,2-7H3,(H,30,37)(H,31,34)(H,35,36)/t21-,22-/m0/s1 |
| InChIKey | PYMVJOOONWKWTQ-VXKWHMMOSA-N |
| XLogP | 3.44 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|