C22H24N2O5 — CID 20643463
3-phenyl-2-[[3-phenyl-2-(prop-2-enoxycarbonylamino)propanoyl]amino]propanoic acid (PubChem CID 20643463) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 3-phenyl-2-[[3-phenyl-2-(prop-2-enoxycarbonylamino)propanoyl]amino]propanoic acid.
| Compound Name | 3-phenyl-2-[[3-phenyl-2-(prop-2-enoxycarbonylamino)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20643463 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 3-phenyl-2-[[3-phenyl-2-(prop-2-enoxycarbonylamino)propanoyl]amino]propanoic acid |
| SMILES | C=CCOC(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H24N2O5/c1-2-13-29-22(28)24-18(14-16-9-5-3-6-10-16)20(25)23-19(21(26)27)15-17-11-7-4-8-12-17/h2-12,18-19H,1,13-15H2,(H,23,25)(H,24,28)(H,26,27) |
| InChIKey | AMKYLOJTYXEETQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|