C20H23N2O4- — CID 131718648
(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid;prop-2-enylazanide (PubChem CID 131718648) has the molecular formula C20H23N2O4- and a molecular weight of 355.41 g/mol. Its IUPAC name is (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid;prop-2-enylazanide.
| Compound Name | (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid;prop-2-enylazanide |
|---|---|
| PubChem CID | 131718648 |
| Molecular Formula | C20H23N2O4- |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid;prop-2-enylazanide |
| SMILES | C=CC[NH-].O=C(N[C@@H](Cc1ccccc1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C17H17NO4.C3H6N/c19-16(20)15(11-13-7-3-1-4-8-13)18-17(21)22-12-14-9-5-2-6-10-14;1-2-3-4/h1-10,15H,11-12H2,(H,18,21)(H,19,20);2,4H,1,3H2/q;-1/t15-;/m0./s1 |
| InChIKey | LINWXAGZNJOLBC-RSAXXLAASA-N |
| XLogP | 3.83 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|