C44H57N3O8 — CID 58484891
tert-butyl 6-[2,2-diphenylethyl(prop-2-enoxycarbonyl)amino]-4-[[(2R)-1-oxo-5-(phenylmethoxycarbonylamino)-1-prop-2-enoxypentan-2-yl]amino]hexanoate (PubChem CID 58484891) has the molecular formula C44H57N3O8 and a molecular weight of 755.95 g/mol. Its IUPAC name is tert-butyl 6-[2,2-diphenylethyl(prop-2-enoxycarbonyl)amino]-4-[[(2R)-1-oxo-5-(phenylmethoxycarbonylamino)-1-prop-2-enoxypentan-2-yl]amino]hexanoate.
| Compound Name | tert-butyl 6-[2,2-diphenylethyl(prop-2-enoxycarbonyl)amino]-4-[[(2R)-1-oxo-5-(phenylmethoxycarbonylamino)-1-prop-2-enoxypentan-2-yl]amino]hexanoate |
|---|---|
| PubChem CID | 58484891 |
| Molecular Formula | C44H57N3O8 |
| Molecular Weight | 755.95 g/mol |
| Exact Mass | 755.41 |
| IUPAC Name | tert-butyl 6-[2,2-diphenylethyl(prop-2-enoxycarbonyl)amino]-4-[[(2R)-1-oxo-5-(phenylmethoxycarbonylamino)-1-prop-2-enoxypentan-2-yl]amino]hexanoate |
| SMILES | C=CCOC(=O)[C@@H](CCCNC(=O)OCc1ccccc1)NC(CCC(=O)OC(C)(C)C)CCN(CC(c1ccccc1)c1ccccc1)C(=O)OCC=C |
| InChI | InChI=1S/C44H57N3O8/c1-6-30-52-41(49)39(24-17-28-45-42(50)54-33-34-18-11-8-12-19-34)46-37(25-26-40(48)55-44(3,4)5)27-29-47(43(51)53-31-7-2)32-38(35-20-13-9-14-21-35)36-22-15-10-16-23-36/h6-16,18-23,37-39,46H,1-2,17,24-33H2,3-5H3,(H,45,50)/t37?,39-/m1/s1 |
| InChIKey | HJKQCVTUQIJOGU-QSFIPEERSA-N |
| XLogP | 7.72 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.95 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|