C24H38N2O6 — CID 71275618
tert-butyl (2R)-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 71275618) has the molecular formula C24H38N2O6 and a molecular weight of 450.58 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | tert-butyl (2R)-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 71275618 |
| Molecular Formula | C24H38N2O6 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | tert-butyl (2R)-2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CC(C)(C)OC(=O)CN[C@H](CCCCNC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38N2O6/c1-23(2,3)31-20(27)16-26-19(21(28)32-24(4,5)6)14-10-11-15-25-22(29)30-17-18-12-8-7-9-13-18/h7-9,12-13,19,26H,10-11,14-17H2,1-6H3,(H,25,29)/t19-/m1/s1 |
| InChIKey | RNVYNKFTUFPQMU-LJQANCHMSA-N |
| XLogP | 3.72 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|