C23H34N2O7 — CID 170690385
5-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 170690385) has the molecular formula C23H34N2O7 and a molecular weight of 450.53 g/mol. Its IUPAC name is 5-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 170690385 |
| Molecular Formula | C23H34N2O7 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 5-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)CCCC(=O)O |
| InChI | InChI=1S/C23H34N2O7/c1-23(2,3)32-21(29)18(25-19(26)13-9-14-20(27)28)12-7-8-15-24-22(30)31-16-17-10-5-4-6-11-17/h4-6,10-11,18H,7-9,12-16H2,1-3H3,(H,24,30)(H,25,26)(H,27,28)/t18-/m0/s1 |
| InChIKey | STZDEFLUJSBDEU-SFHVURJKSA-N |
| XLogP | 3.16 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|