C30H41N3O6 — CID 10324992
tert-butyl (2S)-2-[[(2R)-2-acetamido-2-methyl-3-phenylpropanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 10324992) has the molecular formula C30H41N3O6 and a molecular weight of 539.67 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2R)-2-acetamido-2-methyl-3-phenylpropanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | tert-butyl (2S)-2-[[(2R)-2-acetamido-2-methyl-3-phenylpropanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 10324992 |
| Molecular Formula | C30H41N3O6 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | tert-butyl (2S)-2-[[(2R)-2-acetamido-2-methyl-3-phenylpropanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CC(=O)N[C@](C)(Cc1ccccc1)C(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H41N3O6/c1-22(34)33-30(5,20-23-14-8-6-9-15-23)27(36)32-25(26(35)39-29(2,3)4)18-12-13-19-31-28(37)38-21-24-16-10-7-11-17-24/h6-11,14-17,25H,12-13,18-21H2,1-5H3,(H,31,37)(H,32,36)(H,33,34)/t25-,30+/m0/s1 |
| InChIKey | YXSPHOFVWDSXGN-SETSBSEESA-N |
| XLogP | 4.05 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|