C19H28N2O4 — CID 101273150
tert-butyl 4-(phenylmethoxycarbonylamino)-3-(prop-2-enylamino)butanoate (PubChem CID 101273150) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is tert-butyl 4-(phenylmethoxycarbonylamino)-3-(prop-2-enylamino)butanoate.
| Compound Name | tert-butyl 4-(phenylmethoxycarbonylamino)-3-(prop-2-enylamino)butanoate |
|---|---|
| PubChem CID | 101273150 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | tert-butyl 4-(phenylmethoxycarbonylamino)-3-(prop-2-enylamino)butanoate |
| SMILES | C=CCNC(CNC(=O)OCc1ccccc1)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28N2O4/c1-5-11-20-16(12-17(22)25-19(2,3)4)13-21-18(23)24-14-15-9-7-6-8-10-15/h5-10,16,20H,1,11-14H2,2-4H3,(H,21,23) |
| InChIKey | ORYYEWRABDIISX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|