C20H25N3O4 — CID 59366972
benzyl N-[2-(methylamino)-3-(phenylmethoxycarbonylamino)propyl]carbamate (PubChem CID 59366972) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is benzyl N-[2-(methylamino)-3-(phenylmethoxycarbonylamino)propyl]carbamate.
| Compound Name | benzyl N-[2-(methylamino)-3-(phenylmethoxycarbonylamino)propyl]carbamate |
|---|---|
| PubChem CID | 59366972 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | benzyl N-[2-(methylamino)-3-(phenylmethoxycarbonylamino)propyl]carbamate |
| SMILES | CNC(CNC(=O)OCc1ccccc1)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H25N3O4/c1-21-18(12-22-19(24)26-14-16-8-4-2-5-9-16)13-23-20(25)27-15-17-10-6-3-7-11-17/h2-11,18,21H,12-15H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | PLWOFWSJZDCQFC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |