C13H18N2O2S — CID 118167903
benzyl N-[(2S)-2-methyl-3-(methylamino)-3-sulfanylidenepropyl]carbamate (PubChem CID 118167903) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is benzyl N-[(2S)-2-methyl-3-(methylamino)-3-sulfanylidenepropyl]carbamate.
| Compound Name | benzyl N-[(2S)-2-methyl-3-(methylamino)-3-sulfanylidenepropyl]carbamate |
|---|---|
| PubChem CID | 118167903 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | benzyl N-[(2S)-2-methyl-3-(methylamino)-3-sulfanylidenepropyl]carbamate |
| SMILES | CNC(=S)[C@@H](C)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H18N2O2S/c1-10(12(18)14-2)8-15-13(16)17-9-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H,14,18)(H,15,16)/t10-/m0/s1 |
| InChIKey | CNGRIBAKCKCAAR-JTQLQIEISA-N |
| XLogP | 2.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|