C13H17NO4 — CID 14701263
benzyl N-[(2R,3S)-2,3-dihydroxypent-4-enyl]carbamate (PubChem CID 14701263) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is benzyl N-[(2R,3S)-2,3-dihydroxypent-4-enyl]carbamate.
| Compound Name | benzyl N-[(2R,3S)-2,3-dihydroxypent-4-enyl]carbamate |
|---|---|
| PubChem CID | 14701263 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | benzyl N-[(2R,3S)-2,3-dihydroxypent-4-enyl]carbamate |
| SMILES | C=C[C@H](O)[C@H](O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H17NO4/c1-2-11(15)12(16)8-14-13(17)18-9-10-6-4-3-5-7-10/h2-7,11-12,15-16H,1,8-9H2,(H,14,17)/t11-,12+/m0/s1 |
| InChIKey | ZANSUECGEUCBLU-NWDGAFQWSA-N |
| XLogP | 0.82 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|